C18H34O6Si — CID 71522253
ethyl 4-[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-(methoxymethoxy)-2-methylidenebutanoate (PubChem CID 71522253) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is ethyl 4-[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-(methoxymethoxy)-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-(methoxymethoxy)-2-methylidenebutanoate |
|---|---|
| PubChem CID | 71522253 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | ethyl 4-[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-(methoxymethoxy)-2-methylidenebutanoate |
| SMILES | C=C(CC(OCOC)[C@@H]1O[C@@H]1CO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H34O6Si/c1-9-21-17(19)13(2)10-14(22-12-20-6)16-15(24-16)11-23-25(7,8)18(3,4)5/h14-16H,2,9-12H2,1,3-8H3/t14?,15-,16+/m1/s1 |
| InChIKey | ZTCOLGWBHCFFFQ-JAIYHHTPSA-N |
| XLogP | 3.27 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|