C19H34O5Si — CID 24939031
methyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenylidene-4-(methoxymethoxy)-6-methylhept-6-enoate (PubChem CID 24939031) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenylidene-4-(methoxymethoxy)-6-methylhept-6-enoate.
| Compound Name | methyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenylidene-4-(methoxymethoxy)-6-methylhept-6-enoate |
|---|---|
| PubChem CID | 24939031 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | methyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenylidene-4-(methoxymethoxy)-6-methylhept-6-enoate |
| SMILES | C=C=C(C[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)C(=C)C)C(=O)OC |
| InChI | InChI=1S/C19H34O5Si/c1-11-15(18(20)22-8)12-16(23-13-21-7)17(14(2)3)24-25(9,10)19(4,5)6/h16-17H,1-2,12-13H2,3-10H3/t16-,17-/m1/s1 |
| InChIKey | UVJVJRKPVFYRKC-IAGOWNOFSA-N |
| XLogP | 4.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|