C25H46O7Si — CID 123514746
dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate (PubChem CID 123514746) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate.
| Compound Name | dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate |
|---|---|
| PubChem CID | 123514746 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate |
| SMILES | CCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1C(=CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H46O7Si/c1-11-12-13-14-15-16-19(32-33(9,10)24(2,3)4)22-21(30-25(5,6)31-22)18(23(27)29-8)17-20(26)28-7/h17,19,21-22H,11-16H2,1-10H3/t19-,21-,22-/m0/s1 |
| InChIKey | DSZBDZYOLWNVSH-BVSLBCMMSA-N |
| XLogP | 5.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|