C19H32O6Si — CID 139262765
[(3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-9-oxo-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-6-yl] acetate (PubChem CID 139262765) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is [(3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-9-oxo-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-9-oxo-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 139262765 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(3aR,4S,6R,7Z,9aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-9-oxo-4,5,6,9a-tetrahydro-3aH-cycloocta[d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C\C(=O)[C@H]2OC(C)(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H32O6Si/c1-12(20)22-13-9-10-14(21)16-17(24-19(5,6)23-16)15(11-13)25-26(7,8)18(2,3)4/h9-10,13,15-17H,11H2,1-8H3/b10-9-/t13-,15-,16+,17-/m0/s1 |
| InChIKey | MJTXDVKAMCBPKF-KZLYEQDASA-N |
| XLogP | 3.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|