C21H38O7Si — CID 123244933
dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate (PubChem CID 123244933) has the molecular formula C21H38O7Si and a molecular weight of 430.61 g/mol. Its IUPAC name is dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate.
| Compound Name | dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate |
|---|---|
| PubChem CID | 123244933 |
| Molecular Formula | C21H38O7Si |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | dimethyl 2-[(4S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enedioate |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1C(=CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H38O7Si/c1-11-12-15(28-29(9,10)20(2,3)4)18-17(26-21(5,6)27-18)14(19(23)25-8)13-16(22)24-7/h13,15,17-18H,11-12H2,1-10H3/t15-,17-,18-/m0/s1 |
| InChIKey | QHCWRRBSPRTTLB-SZMVWBNQSA-N |
| XLogP | 3.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|