C15H20O8 — CID 11301884
methyl (3aR,6S,7R,7aR)-6,7-diacetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 11301884) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is methyl (3aR,6S,7R,7aR)-6,7-diacetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,6S,7R,7aR)-6,7-diacetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11301884 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl (3aR,6S,7R,7aR)-6,7-diacetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OC(C)(C)O[C@H]2[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O8/c1-7(16)20-11-9(14(18)19-5)6-10-12(13(11)21-8(2)17)23-15(3,4)22-10/h6,10-13H,1-5H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | UQGJUAIWQKUXMQ-YVECIDJPSA-N |
| XLogP | 0.48 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|