C21H42O5Si2 — CID 139085651
methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxycyclohexene-1-carboxylate (PubChem CID 139085651) has the molecular formula C21H42O5Si2 and a molecular weight of 430.73 g/mol. Its IUPAC name is methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 139085651 |
| Molecular Formula | C21H42O5Si2 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H42O5Si2/c1-20(2,3)27(9,10)25-16-13-15(19(22)24-8)14-17(18(16)23-7)26-28(11,12)21(4,5)6/h13,16-18H,14H2,1-12H3/t16-,17-,18-/m1/s1 |
| InChIKey | YFALIZNEZREBIX-KZNAEPCWSA-N |
| XLogP | 5.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|