C26H42O8 — CID 162908699
methyl (3R,4S,5R)-3,5-bis[[(2R)-2-methylbutanoyl]oxy]-4-octanoyloxycyclohexene-1-carboxylate (PubChem CID 162908699) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is methyl (3R,4S,5R)-3,5-bis[[(2R)-2-methylbutanoyl]oxy]-4-octanoyloxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-3,5-bis[[(2R)-2-methylbutanoyl]oxy]-4-octanoyloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 162908699 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | methyl (3R,4S,5R)-3,5-bis[[(2R)-2-methylbutanoyl]oxy]-4-octanoyloxycyclohexene-1-carboxylate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)[C@H](C)CC)C=C(C(=O)OC)C[C@H]1OC(=O)[C@H](C)CC |
| InChI | InChI=1S/C26H42O8/c1-7-10-11-12-13-14-22(27)34-23-20(32-24(28)17(4)8-2)15-19(26(30)31-6)16-21(23)33-25(29)18(5)9-3/h15,17-18,20-21,23H,7-14,16H2,1-6H3/t17-,18-,20-,21-,23-/m1/s1 |
| InChIKey | MNFDSXQRQGMGGE-OPYGSTPGSA-N |
| XLogP | 4.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|