C28H46O8 — CID 163035895
methyl (3R,4S,5R)-4-decanoyloxy-3,5-bis[[(2R)-2-methylbutanoyl]oxy]cyclohexene-1-carboxylate (PubChem CID 163035895) has the molecular formula C28H46O8 and a molecular weight of 510.67 g/mol. Its IUPAC name is methyl (3R,4S,5R)-4-decanoyloxy-3,5-bis[[(2R)-2-methylbutanoyl]oxy]cyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-4-decanoyloxy-3,5-bis[[(2R)-2-methylbutanoyl]oxy]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 163035895 |
| Molecular Formula | C28H46O8 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | methyl (3R,4S,5R)-4-decanoyloxy-3,5-bis[[(2R)-2-methylbutanoyl]oxy]cyclohexene-1-carboxylate |
| SMILES | CCCCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)[C@H](C)CC)C=C(C(=O)OC)C[C@H]1OC(=O)[C@H](C)CC |
| InChI | InChI=1S/C28H46O8/c1-7-10-11-12-13-14-15-16-24(29)36-25-22(34-26(30)19(4)8-2)17-21(28(32)33-6)18-23(25)35-27(31)20(5)9-3/h17,19-20,22-23,25H,7-16,18H2,1-6H3/t19-,20-,22-,23-,25-/m1/s1 |
| InChIKey | HIIAFEDNUDOAMG-HPUHJGTRSA-N |
| XLogP | 5.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|