C23H38O5Si — CID 134962603
ethyl (2Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-6-enoate (PubChem CID 134962603) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is ethyl (2Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-6-enoate.
| Compound Name | ethyl (2Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-6-enoate |
|---|---|
| PubChem CID | 134962603 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | ethyl (2Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-6-enoate |
| SMILES | C=C(C)C[C@@H](C/C(=C/CCC1=CCOC1=O)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38O5Si/c1-9-26-22(25)19(12-10-11-18-13-14-27-21(18)24)16-20(15-17(2)3)28-29(7,8)23(4,5)6/h12-13,20H,2,9-11,14-16H2,1,3-8H3/b19-12-/t20-/m0/s1 |
| InChIKey | PXMUDHVYMQXJTQ-CBXNMNPBSA-N |
| XLogP | 5.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|