C19H35BrO6Si — CID 16756915
methyl (3S,4R,5R)-3-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxycyclohexene-1-carboxylate (PubChem CID 16756915) has the molecular formula C19H35BrO6Si and a molecular weight of 467.47 g/mol. Its IUPAC name is methyl (3S,4R,5R)-3-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxycyclohexene-1-carboxylate.
| Compound Name | methyl (3S,4R,5R)-3-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 16756915 |
| Molecular Formula | C19H35BrO6Si |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | methyl (3S,4R,5R)-3-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxycyclohexene-1-carboxylate |
| SMILES | CCOC(CBr)O[C@H]1C=C(C(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C19H35BrO6Si/c1-9-24-16(12-20)25-14-10-13(18(21)23-6)11-15(17(14)22-5)26-27(7,8)19(2,3)4/h10,14-17H,9,11-12H2,1-8H3/t14-,15+,16?,17+/m0/s1 |
| InChIKey | JDPAYIMCVGMBCD-RUENRELNSA-N |
| XLogP | 4.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|