C27H44O8 — CID 163040503
methyl (3R,4S,5R)-4-decanoyloxy-3-[(2R)-2-methylbutanoyl]oxy-5-(2-methylpropanoyloxy)cyclohexene-1-carboxylate (PubChem CID 163040503) has the molecular formula C27H44O8 and a molecular weight of 496.64 g/mol. Its IUPAC name is methyl (3R,4S,5R)-4-decanoyloxy-3-[(2R)-2-methylbutanoyl]oxy-5-(2-methylpropanoyloxy)cyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-4-decanoyloxy-3-[(2R)-2-methylbutanoyl]oxy-5-(2-methylpropanoyloxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 163040503 |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | methyl (3R,4S,5R)-4-decanoyloxy-3-[(2R)-2-methylbutanoyl]oxy-5-(2-methylpropanoyloxy)cyclohexene-1-carboxylate |
| SMILES | CCCCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)[C@H](C)CC)C=C(C(=O)OC)C[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C27H44O8/c1-7-9-10-11-12-13-14-15-23(28)35-24-21(33-25(29)18(3)4)16-20(27(31)32-6)17-22(24)34-26(30)19(5)8-2/h17-19,21-22,24H,7-16H2,1-6H3/t19-,21-,22-,24+/m1/s1 |
| InChIKey | PMDCKDXMRHEFLJ-YJRNTSOCSA-N |
| XLogP | 5.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|