C18H32O6Si — CID 101472099
ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 101472099) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101472099 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyacetyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(C)(C)O[C@H]1C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O6Si/c1-9-21-15(20)11-10-14-16(24-18(5,6)23-14)13(19)12-22-25(7,8)17(2,3)4/h10-11,14,16H,9,12H2,1-8H3/b11-10+/t14-,16+/m1/s1 |
| InChIKey | IVVRKJQTYCNHDB-AGEWCLKBSA-N |
| XLogP | 3.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|