C15H26O4Si — CID 14679840
(3aR,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one (PubChem CID 14679840) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is (3aR,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 14679840 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3aR,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H26O4Si/c1-14(2,3)20(6,7)19-11-9-8-10(16)12-13(11)18-15(4,5)17-12/h8-9,11-13H,1-7H3/t11-,12-,13+/m0/s1 |
| InChIKey | BCCOFNDPPMWOLJ-RWMBFGLXSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|