C16H27IO4Si — CID 23629598
(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,2,7a-trimethyl-3a,7-dihydro-1,3-benzodioxol-4-one (PubChem CID 23629598) has the molecular formula C16H27IO4Si and a molecular weight of 438.38 g/mol. Its IUPAC name is (3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,2,7a-trimethyl-3a,7-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,2,7a-trimethyl-3a,7-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 23629598 |
| Molecular Formula | C16H27IO4Si |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,2,7a-trimethyl-3a,7-dihydro-1,3-benzodioxol-4-one |
| SMILES | CC1(C)O[C@@H]2C(=O)C(I)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C16H27IO4Si/c1-14(2,3)22(7,8)20-11-9-10(17)12(18)13-16(11,6)21-15(4,5)19-13/h9,11,13H,1-8H3/t11-,13-,16+/m1/s1 |
| InChIKey | JPXPLOYAICDLJT-KFNAQCHYSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|