C18H32O5Si — CID 134844717
[(6R)-5-oxo-6-[2-tri(propan-2-yl)silyloxyethyl]-2H-pyran-2-yl] acetate (PubChem CID 134844717) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is [(6R)-5-oxo-6-[2-tri(propan-2-yl)silyloxyethyl]-2H-pyran-2-yl] acetate.
| Compound Name | [(6R)-5-oxo-6-[2-tri(propan-2-yl)silyloxyethyl]-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 134844717 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(6R)-5-oxo-6-[2-tri(propan-2-yl)silyloxyethyl]-2H-pyran-2-yl] acetate |
| SMILES | CC(=O)OC1C=CC(=O)[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C18H32O5Si/c1-12(2)24(13(3)4,14(5)6)21-11-10-17-16(20)8-9-18(23-17)22-15(7)19/h8-9,12-14,17-18H,10-11H2,1-7H3/t17-,18?/m1/s1 |
| InChIKey | WGRQGENXEIKZHH-QNSVNVJESA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|