C19H34O6Si — CID 24778249
tert-butyl [(2R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] carbonate (PubChem CID 24778249) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is tert-butyl [(2R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] carbonate.
| Compound Name | tert-butyl [(2R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] carbonate |
|---|---|
| PubChem CID | 24778249 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | tert-butyl [(2R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)O[C@@H]1C=CC(=O)[C@@H](CCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H34O6Si/c1-18(2,3)25-17(21)24-16-12-11-14(20)15(23-16)10-9-13-22-26(7,8)19(4,5)6/h11-12,15-16H,9-10,13H2,1-8H3/t15-,16-/m1/s1 |
| InChIKey | ADRMGJIDGLWTST-HZPDHXFCSA-N |
| XLogP | 4.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|