C18H28O6 — CID 101452243
3-[(2S,6S)-2-(2,2-dimethylpropanoyloxy)-5-oxo-2H-pyran-6-yl]propyl 2,2-dimethylpropanoate (PubChem CID 101452243) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[(2S,6S)-2-(2,2-dimethylpropanoyloxy)-5-oxo-2H-pyran-6-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,6S)-2-(2,2-dimethylpropanoyloxy)-5-oxo-2H-pyran-6-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101452243 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3-[(2S,6S)-2-(2,2-dimethylpropanoyloxy)-5-oxo-2H-pyran-6-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@@H]1O[C@@H](OC(=O)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C18H28O6/c1-17(2,3)15(20)22-11-7-8-13-12(19)9-10-14(23-13)24-16(21)18(4,5)6/h9-10,13-14H,7-8,11H2,1-6H3/t13-,14-/m0/s1 |
| InChIKey | DDDMZOGVNJNIQR-KBPBESRZSA-N |
| XLogP | 2.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|