C16H22O7 — CID 134842944
(3E,6S,9E,11S,14S)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione (PubChem CID 134842944) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is (3E,6S,9E,11S,14S)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione.
| Compound Name | (3E,6S,9E,11S,14S)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione |
|---|---|
| PubChem CID | 134842944 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3E,6S,9E,11S,14S)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione |
| SMILES | COCO[C@@H]1/C=C/C(=O)O[C@@H](C)C(=O)/C=C/C(=O)O[C@@H](C)CC1 |
| InChI | InChI=1S/C16H22O7/c1-11-4-5-13(21-10-20-3)6-8-16(19)23-12(2)14(17)7-9-15(18)22-11/h6-9,11-13H,4-5,10H2,1-3H3/b8-6+,9-7+/t11-,12-,13-/m0/s1 |
| InChIKey | PYLUUGSBLXFEMN-NUEXEXHJSA-N |
| XLogP | 1.31 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|