C16H24O6 — CID 44604189
(3E,6R,9E,11R,14R)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione (PubChem CID 44604189) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3E,6R,9E,11R,14R)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione.
| Compound Name | (3E,6R,9E,11R,14R)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione |
|---|---|
| PubChem CID | 44604189 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3E,6R,9E,11R,14R)-11-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione |
| SMILES | COCO[C@H]1/C=C/C(=O)O[C@H](C)C/C=C/C(=O)O[C@H](C)CC1 |
| InChI | InChI=1S/C16H24O6/c1-12-5-4-6-15(17)22-13(2)7-8-14(20-11-19-3)9-10-16(18)21-12/h4,6,9-10,12-14H,5,7-8,11H2,1-3H3/b6-4+,10-9+/t12-,13-,14-/m1/s1 |
| InChIKey | MRDDAKSUTVYLJO-VIYNOMJPSA-N |
| XLogP | 2.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|