C18H28O6 — CID 44604188
[(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5R)-5-prop-2-enoyloxyhex-2-enoate (PubChem CID 44604188) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5R)-5-prop-2-enoyloxyhex-2-enoate.
| Compound Name | [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5R)-5-prop-2-enoyloxyhex-2-enoate |
|---|---|
| PubChem CID | 44604188 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5R)-5-prop-2-enoyloxyhex-2-enoate |
| SMILES | C=CC(=O)O[C@H](C)C/C=C/C(=O)O[C@H](C)CC[C@H](C=C)OCOC |
| InChI | InChI=1S/C18H28O6/c1-6-16(22-13-21-5)12-11-15(4)24-18(20)10-8-9-14(3)23-17(19)7-2/h6-8,10,14-16H,1-2,9,11-13H2,3-5H3/b10-8+/t14-,15-,16+/m1/s1 |
| InChIKey | XTPYWJFGPVFRFL-SSOCVUBWSA-N |
| XLogP | 2.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|