C13H16O5 — CID 135074985
[(2R,6S)-5-oxo-6-[(E)-6-oxohex-4-enyl]-2H-pyran-2-yl] acetate (PubChem CID 135074985) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(2R,6S)-5-oxo-6-[(E)-6-oxohex-4-enyl]-2H-pyran-2-yl] acetate.
| Compound Name | [(2R,6S)-5-oxo-6-[(E)-6-oxohex-4-enyl]-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 135074985 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(2R,6S)-5-oxo-6-[(E)-6-oxohex-4-enyl]-2H-pyran-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CC(=O)[C@H](CCC/C=C/C=O)O1 |
| InChI | InChI=1S/C13H16O5/c1-10(15)17-13-8-7-11(16)12(18-13)6-4-2-3-5-9-14/h3,5,7-9,12-13H,2,4,6H2,1H3/b5-3+/t12-,13-/m0/s1 |
| InChIKey | XYQAITJZCRFZCM-CDBNLRSOSA-N |
| XLogP | 1.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|