C16H28O5Si — CID 101131965
[6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] acetate (PubChem CID 101131965) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is [6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] acetate.
| Compound Name | [6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] acetate |
|---|---|
| PubChem CID | 101131965 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-pyran-2-yl] acetate |
| SMILES | CC(=O)OC1C=CC(=O)C(CCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H28O5Si/c1-12(17)20-15-10-9-13(18)14(21-15)8-7-11-19-22(5,6)16(2,3)4/h9-10,14-15H,7-8,11H2,1-6H3 |
| InChIKey | RVFHORVQPCESFB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|