C16H22O7 — CID 10544101
(3E,6R,9E,12R,14R)-12-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8,11-trione (PubChem CID 10544101) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is (3E,6R,9E,12R,14R)-12-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8,11-trione.
| Compound Name | (3E,6R,9E,12R,14R)-12-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8,11-trione |
|---|---|
| PubChem CID | 10544101 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3E,6R,9E,12R,14R)-12-(methoxymethoxy)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8,11-trione |
| SMILES | COCO[C@@H]1C[C@@H](C)OC(=O)/C=C/C[C@@H](C)OC(=O)/C=C/C1=O |
| InChI | InChI=1S/C16H22O7/c1-11-5-4-6-15(18)23-12(2)9-14(21-10-20-3)13(17)7-8-16(19)22-11/h4,6-8,11-12,14H,5,9-10H2,1-3H3/b6-4+,8-7+/t11-,12-,14-/m1/s1 |
| InChIKey | QAQBVGPOLCCPIN-WOYYAFRCSA-N |
| XLogP | 1.31 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|