C10H12O5 — CID 135043919
[(1R,5S)-5-acetyloxy-4-oxocyclohex-2-en-1-yl] acetate (PubChem CID 135043919) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is [(1R,5S)-5-acetyloxy-4-oxocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,5S)-5-acetyloxy-4-oxocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 135043919 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | [(1R,5S)-5-acetyloxy-4-oxocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC(C)=O)C=CC1=O |
| InChI | InChI=1S/C10H12O5/c1-6(11)14-8-3-4-9(13)10(5-8)15-7(2)12/h3-4,8,10H,5H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | RQXOZJMAAZRJRN-WPRPVWTQSA-N |
| XLogP | 0.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |