C17H32O5Si — CID 5366930
(E)-3-[5-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid (PubChem CID 5366930) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is (E)-3-[5-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 5366930 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (E)-3-[5-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoic acid |
| SMILES | CC(CC1OC(C)(C)OC1/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O5Si/c1-12(22-23(7,8)16(2,3)4)11-14-13(9-10-15(18)19)20-17(5,6)21-14/h9-10,12-14H,11H2,1-8H3,(H,18,19)/b10-9+ |
| InChIKey | FHFMZZMEAXGXNE-MDZDMXLPSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|