C33H60O6Si2 — CID 11685860
(2E,4E,6E,8E,10E,12S,13S,15S)-13,15-bis[[tert-butyl(dimethyl)silyl]oxy]-12-(methoxymethoxy)-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid (PubChem CID 11685860) has the molecular formula C33H60O6Si2 and a molecular weight of 609.01 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12S,13S,15S)-13,15-bis[[tert-butyl(dimethyl)silyl]oxy]-12-(methoxymethoxy)-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,12S,13S,15S)-13,15-bis[[tert-butyl(dimethyl)silyl]oxy]-12-(methoxymethoxy)-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 11685860 |
| Molecular Formula | C33H60O6Si2 |
| Molecular Weight | 609.01 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | (2E,4E,6E,8E,10E,12S,13S,15S)-13,15-bis[[tert-butyl(dimethyl)silyl]oxy]-12-(methoxymethoxy)-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid |
| SMILES | COCO[C@@H](/C=C(C)/C=C/C=C(C)/C=C(C)/C=C/C(=O)O)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H60O6Si2/c1-25(21-27(3)19-20-31(34)35)17-16-18-26(2)22-29(37-24-36-11)30(39-41(14,15)33(8,9)10)23-28(4)38-40(12,13)32(5,6)7/h16-22,28-30H,23-24H2,1-15H3,(H,34,35)/b18-16+,20-19+,25-17+,26-22+,27-21+/t28-,29-,30-/m0/s1 |
| InChIKey | WYQDOYNHTSAMNR-VTYZZNNXSA-N |
| XLogP | 9.20 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.01 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|