C39H72O5Si3 — CID 162397432
(E)-3-[2-[(2E,4E,6E,8S,9S,11S)-8,9,11-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyldodeca-2,4,6-trien-2-yl]cyclopenten-1-yl]prop-2-enoic acid (PubChem CID 162397432) has the molecular formula C39H72O5Si3 and a molecular weight of 705.26 g/mol. Its IUPAC name is (E)-3-[2-[(2E,4E,6E,8S,9S,11S)-8,9,11-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyldodeca-2,4,6-trien-2-yl]cyclopenten-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(2E,4E,6E,8S,9S,11S)-8,9,11-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyldodeca-2,4,6-trien-2-yl]cyclopenten-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162397432 |
| Molecular Formula | C39H72O5Si3 |
| Molecular Weight | 705.26 g/mol |
| Exact Mass | 704.47 |
| IUPAC Name | (E)-3-[2-[(2E,4E,6E,8S,9S,11S)-8,9,11-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyldodeca-2,4,6-trien-2-yl]cyclopenten-1-yl]prop-2-enoic acid |
| SMILES | CC(/C=C/C=C(\C)C1=C(/C=C/C(=O)O)CCC1)=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H72O5Si3/c1-29(21-19-22-30(2)33-24-20-23-32(33)25-26-36(40)41)27-34(43-46(15,16)38(7,8)9)35(44-47(17,18)39(10,11)12)28-31(3)42-45(13,14)37(4,5)6/h19,21-22,25-27,31,34-35H,20,23-24,28H2,1-18H3,(H,40,41)/b21-19+,26-25+,29-27+,30-22+/t31-,34-,35-/m0/s1 |
| InChIKey | CPAGQGSQVJYXPI-CSIZMPOFSA-N |
| XLogP | 12.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.26 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|