C42H82O6Si4 — CID 11714788
(2E,4E,8R,9R,11S,12S)-3-methyl-7,10-dimethylidene-8,9,11,12-tetrakis(triethylsilyloxy)pentadeca-2,4,14-trienoic acid (PubChem CID 11714788) has the molecular formula C42H82O6Si4 and a molecular weight of 795.46 g/mol. Its IUPAC name is (2E,4E,8R,9R,11S,12S)-3-methyl-7,10-dimethylidene-8,9,11,12-tetrakis(triethylsilyloxy)pentadeca-2,4,14-trienoic acid.
| Compound Name | (2E,4E,8R,9R,11S,12S)-3-methyl-7,10-dimethylidene-8,9,11,12-tetrakis(triethylsilyloxy)pentadeca-2,4,14-trienoic acid |
|---|---|
| PubChem CID | 11714788 |
| Molecular Formula | C42H82O6Si4 |
| Molecular Weight | 795.46 g/mol |
| Exact Mass | 794.52 |
| IUPAC Name | (2E,4E,8R,9R,11S,12S)-3-methyl-7,10-dimethylidene-8,9,11,12-tetrakis(triethylsilyloxy)pentadeca-2,4,14-trienoic acid |
| SMILES | C=CC[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)C(=C)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)C(=C)C/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C42H82O6Si4/c1-17-31-38(45-49(18-2,19-3)20-4)41(47-51(24-8,25-9)26-10)37(16)42(48-52(27-11,28-12)29-13)40(46-50(21-5,22-6)23-7)36(15)33-30-32-35(14)34-39(43)44/h17,30,32,34,38,40-42H,1,15-16,18-29,31,33H2,2-14H3,(H,43,44)/b32-30+,35-34+/t38-,40+,41-,42+/m0/s1 |
| InChIKey | FXCCDIBQZNLRMI-URYUQUHGSA-N |
| XLogP | 13.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.46 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|