C17H32O3Si — CID 135032781
tert-butyl (2E,4R)-4-triethylsilyloxyhepta-2,6-dienoate (PubChem CID 135032781) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl (2E,4R)-4-triethylsilyloxyhepta-2,6-dienoate.
| Compound Name | tert-butyl (2E,4R)-4-triethylsilyloxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 135032781 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | tert-butyl (2E,4R)-4-triethylsilyloxyhepta-2,6-dienoate |
| SMILES | C=CC[C@H](/C=C/C(=O)OC(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H32O3Si/c1-8-12-15(20-21(9-2,10-3)11-4)13-14-16(18)19-17(5,6)7/h8,13-15H,1,9-12H2,2-7H3/b14-13+/t15-/m1/s1 |
| InChIKey | TWUCOEHSJYXBHK-SZGUKTLCSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|