C19H32O3 — CID 142235512
tert-butyl 5-[(2-methylpropan-2-yl)oxy]-4-(2-methylpropyl)hepta-2,5,6-trienoate (PubChem CID 142235512) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is tert-butyl 5-[(2-methylpropan-2-yl)oxy]-4-(2-methylpropyl)hepta-2,5,6-trienoate.
| Compound Name | tert-butyl 5-[(2-methylpropan-2-yl)oxy]-4-(2-methylpropyl)hepta-2,5,6-trienoate |
|---|---|
| PubChem CID | 142235512 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | tert-butyl 5-[(2-methylpropan-2-yl)oxy]-4-(2-methylpropyl)hepta-2,5,6-trienoate |
| SMILES | C=C=C(OC(C)(C)C)C(C=CC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C19H32O3/c1-10-16(21-18(4,5)6)15(13-14(2)3)11-12-17(20)22-19(7,8)9/h11-12,14-15H,1,13H2,2-9H3 |
| InChIKey | MNTRXHRYNVLRQK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|