C13H22O4 — CID 122373670
tert-butyl (2E,4R,5R)-4-hydroxy-5-(hydroxymethyl)octa-2,7-dienoate (PubChem CID 122373670) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is tert-butyl (2E,4R,5R)-4-hydroxy-5-(hydroxymethyl)octa-2,7-dienoate.
| Compound Name | tert-butyl (2E,4R,5R)-4-hydroxy-5-(hydroxymethyl)octa-2,7-dienoate |
|---|---|
| PubChem CID | 122373670 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | tert-butyl (2E,4R,5R)-4-hydroxy-5-(hydroxymethyl)octa-2,7-dienoate |
| SMILES | C=CC[C@H](CO)[C@H](O)/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22O4/c1-5-6-10(9-14)11(15)7-8-12(16)17-13(2,3)4/h5,7-8,10-11,14-15H,1,6,9H2,2-4H3/b8-7+/t10-,11-/m1/s1 |
| InChIKey | YUTAEZHCGOQPKO-QSNNZYTBSA-N |
| XLogP | 1.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|