C13H24O8 — CID 11808995
tert-butyl (E,4S,5S,6R,7R,8R)-4,5,6,7,8,9-hexahydroxynon-2-enoate (PubChem CID 11808995) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is tert-butyl (E,4S,5S,6R,7R,8R)-4,5,6,7,8,9-hexahydroxynon-2-enoate.
| Compound Name | tert-butyl (E,4S,5S,6R,7R,8R)-4,5,6,7,8,9-hexahydroxynon-2-enoate |
|---|---|
| PubChem CID | 11808995 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | tert-butyl (E,4S,5S,6R,7R,8R)-4,5,6,7,8,9-hexahydroxynon-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H24O8/c1-13(2,3)21-9(17)5-4-7(15)10(18)12(20)11(19)8(16)6-14/h4-5,7-8,10-12,14-16,18-20H,6H2,1-3H3/b5-4+/t7-,8+,10-,11+,12+/m0/s1 |
| InChIKey | YFSONGCTMDSKOW-QIDCELAISA-N |
| XLogP | -2.32 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|