C14H24O6 — CID 122233464
[(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] (E,4R,5S)-4,5-dihydroxyhex-2-enoate (PubChem CID 122233464) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is [(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] (E,4R,5S)-4,5-dihydroxyhex-2-enoate.
| Compound Name | [(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] (E,4R,5S)-4,5-dihydroxyhex-2-enoate |
|---|---|
| PubChem CID | 122233464 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] (E,4R,5S)-4,5-dihydroxyhex-2-enoate |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)OC(=O)/C=C/[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C14H24O6/c1-9(8-13(18)20-14(3,4)5)19-12(17)7-6-11(16)10(2)15/h6-7,9-11,15-16H,8H2,1-5H3/b7-6+/t9-,10+,11-/m1/s1 |
| InChIKey | NEPOPJLOVMGJGW-VONSALPUSA-N |
| XLogP | 0.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|