C23H42O3Si — CID 10524702
methyl (2Z,4S,5R,6E,8E)-4,6,8,10,10-pentamethyl-5-triethylsilyloxyundeca-2,6,8-trienoate (PubChem CID 10524702) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is methyl (2Z,4S,5R,6E,8E)-4,6,8,10,10-pentamethyl-5-triethylsilyloxyundeca-2,6,8-trienoate.
| Compound Name | methyl (2Z,4S,5R,6E,8E)-4,6,8,10,10-pentamethyl-5-triethylsilyloxyundeca-2,6,8-trienoate |
|---|---|
| PubChem CID | 10524702 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | methyl (2Z,4S,5R,6E,8E)-4,6,8,10,10-pentamethyl-5-triethylsilyloxyundeca-2,6,8-trienoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](/C(C)=C/C(C)=C/C(C)(C)C)[C@@H](C)/C=C\C(=O)OC |
| InChI | InChI=1S/C23H42O3Si/c1-11-27(12-2,13-3)26-22(19(5)14-15-21(24)25-10)20(6)16-18(4)17-23(7,8)9/h14-17,19,22H,11-13H2,1-10H3/b15-14-,18-17+,20-16+/t19-,22+/m0/s1 |
| InChIKey | HQFRTUFNXQNEHD-POCSCAELSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|