C19H37NO3Si — CID 134866005
(2R,3S,4E,6E)-N-methoxy-N,2,4,6-tetramethyl-3-triethylsilyloxyocta-4,6-dienamide (PubChem CID 134866005) has the molecular formula C19H37NO3Si and a molecular weight of 355.60 g/mol. Its IUPAC name is (2R,3S,4E,6E)-N-methoxy-N,2,4,6-tetramethyl-3-triethylsilyloxyocta-4,6-dienamide.
| Compound Name | (2R,3S,4E,6E)-N-methoxy-N,2,4,6-tetramethyl-3-triethylsilyloxyocta-4,6-dienamide |
|---|---|
| PubChem CID | 134866005 |
| Molecular Formula | C19H37NO3Si |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2R,3S,4E,6E)-N-methoxy-N,2,4,6-tetramethyl-3-triethylsilyloxyocta-4,6-dienamide |
| SMILES | C/C=C(C)/C=C(\C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C19H37NO3Si/c1-10-15(5)14-16(6)18(17(7)19(21)20(8)22-9)23-24(11-2,12-3)13-4/h10,14,17-18H,11-13H2,1-9H3/b15-10+,16-14+/t17-,18-/m1/s1 |
| InChIKey | QDVUMDWTZWQQMP-VKGZXBFCSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|