C9H17NO3 — CID 130367251
(2S,3S)-3-(hydroxymethyl)-N-methoxy-N,2-dimethylpent-4-enamide (PubChem CID 130367251) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (2S,3S)-3-(hydroxymethyl)-N-methoxy-N,2-dimethylpent-4-enamide.
| Compound Name | (2S,3S)-3-(hydroxymethyl)-N-methoxy-N,2-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 130367251 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2S,3S)-3-(hydroxymethyl)-N-methoxy-N,2-dimethylpent-4-enamide |
| SMILES | C=C[C@H](CO)[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C9H17NO3/c1-5-8(6-11)7(2)9(12)10(3)13-4/h5,7-8,11H,1,6H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | KOKHFFOAVRBLKK-JGVFFNPUSA-N |
| XLogP | 0.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|