C8H13NO3 — CID 11116505
(2R,3R)-3-hydroxy-N-methoxy-N,2-dimethylpent-4-ynamide (PubChem CID 11116505) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethylpent-4-ynamide.
| Compound Name | (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethylpent-4-ynamide |
|---|---|
| PubChem CID | 11116505 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethylpent-4-ynamide |
| SMILES | C#C[C@H](O)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C8H13NO3/c1-5-7(10)6(2)8(11)9(3)12-4/h1,6-7,10H,2-4H3/t6-,7+/m1/s1 |
| InChIKey | UYBPBLSUFPNDBD-RQJHMYQMSA-N |
| XLogP | -0.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|