C11H21NO3Si — CID 11817385
(2R,3R)-3-hydroxy-N-methoxy-N,2-dimethyl-5-trimethylsilylpent-4-ynamide (PubChem CID 11817385) has the molecular formula C11H21NO3Si and a molecular weight of 243.38 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethyl-5-trimethylsilylpent-4-ynamide.
| Compound Name | (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethyl-5-trimethylsilylpent-4-ynamide |
|---|---|
| PubChem CID | 11817385 |
| Molecular Formula | C11H21NO3Si |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R,3R)-3-hydroxy-N-methoxy-N,2-dimethyl-5-trimethylsilylpent-4-ynamide |
| SMILES | CON(C)C(=O)[C@H](C)[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H21NO3Si/c1-9(11(14)12(2)15-3)10(13)7-8-16(4,5)6/h9-10,13H,1-6H3/t9-,10+/m1/s1 |
| InChIKey | XFSKFQLNQNXBQL-ZJUUUORDSA-N |
| XLogP | 0.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|