C9H18O2Si — CID 130659352
(2R,3R)-2-methyl-5-trimethylsilylpent-4-yne-1,3-diol (PubChem CID 130659352) has the molecular formula C9H18O2Si and a molecular weight of 186.33 g/mol. Its IUPAC name is (2R,3R)-2-methyl-5-trimethylsilylpent-4-yne-1,3-diol.
| Compound Name | (2R,3R)-2-methyl-5-trimethylsilylpent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 130659352 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2R,3R)-2-methyl-5-trimethylsilylpent-4-yne-1,3-diol |
| SMILES | C[C@H](CO)[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C9H18O2Si/c1-8(7-10)9(11)5-6-12(2,3)4/h8-11H,7H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | SNAZIEYFDUWDQV-BDAKNGLRSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|