C10H18O2Si — CID 102124553
(3S,4S)-1-trimethylsilylhept-6-en-1-yne-3,4-diol (PubChem CID 102124553) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is (3S,4S)-1-trimethylsilylhept-6-en-1-yne-3,4-diol.
| Compound Name | (3S,4S)-1-trimethylsilylhept-6-en-1-yne-3,4-diol |
|---|---|
| PubChem CID | 102124553 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (3S,4S)-1-trimethylsilylhept-6-en-1-yne-3,4-diol |
| SMILES | C=CC[C@H](O)[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H18O2Si/c1-5-6-9(11)10(12)7-8-13(2,3)4/h5,9-12H,1,6H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | ARJYPNQFAYUSGX-UWVGGRQHSA-N |
| XLogP | 1.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|