C9H18OSi — CID 14084682
(2R,3S)-3-methyl-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 14084682) has the molecular formula C9H18OSi and a molecular weight of 170.33 g/mol. Its IUPAC name is (2R,3S)-3-methyl-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2R,3S)-3-methyl-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 14084682 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2R,3S)-3-methyl-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | C[C@@H](O)[C@@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C9H18OSi/c1-8(9(2)10)6-7-11(3,4)5/h8-10H,1-5H3/t8-,9+/m0/s1 |
| InChIKey | QREYWZDZPBFOBL-DTWKUNHWSA-N |
| XLogP | 1.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|