C11H23NSi — CID 100943521
2,2,3-trimethyl-5-trimethylsilylpent-4-yn-1-amine (PubChem CID 100943521) has the molecular formula C11H23NSi and a molecular weight of 197.40 g/mol. Its IUPAC name is 2,2,3-trimethyl-5-trimethylsilylpent-4-yn-1-amine.
| Compound Name | 2,2,3-trimethyl-5-trimethylsilylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 100943521 |
| Molecular Formula | C11H23NSi |
| Molecular Weight | 197.40 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 2,2,3-trimethyl-5-trimethylsilylpent-4-yn-1-amine |
| SMILES | CC(C#C[Si](C)(C)C)C(C)(C)CN |
| InChI | InChI=1S/C11H23NSi/c1-10(11(2,3)9-12)7-8-13(4,5)6/h10H,9,12H2,1-6H3 |
| InChIKey | FQJYWTZJEOBQDA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|