C10H20O2Si — CID 11827016
(2S,3R)-2-methyl-2-(2-trimethylsilylethynyl)butane-1,3-diol (PubChem CID 11827016) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is (2S,3R)-2-methyl-2-(2-trimethylsilylethynyl)butane-1,3-diol.
| Compound Name | (2S,3R)-2-methyl-2-(2-trimethylsilylethynyl)butane-1,3-diol |
|---|---|
| PubChem CID | 11827016 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2S,3R)-2-methyl-2-(2-trimethylsilylethynyl)butane-1,3-diol |
| SMILES | C[C@@H](O)[C@@](C)(C#C[Si](C)(C)C)CO |
| InChI | InChI=1S/C10H20O2Si/c1-9(12)10(2,8-11)6-7-13(3,4)5/h9,11-12H,8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | VESCRFANEJCLEU-ZJUUUORDSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|