C19H37CuO2Si2 — CID 139105386
copper(1+);(Z)-2,2,7-trimethyl-5-oxooct-3-en-3-olate;trimethyl(2-trimethylsilylethynyl)silane (PubChem CID 139105386) has the molecular formula C19H37CuO2Si2 and a molecular weight of 417.22 g/mol. Its IUPAC name is copper(1+);(Z)-2,2,7-trimethyl-5-oxooct-3-en-3-olate;trimethyl(2-trimethylsilylethynyl)silane.
| Compound Name | copper(1+);(Z)-2,2,7-trimethyl-5-oxooct-3-en-3-olate;trimethyl(2-trimethylsilylethynyl)silane |
|---|---|
| PubChem CID | 139105386 |
| Molecular Formula | C19H37CuO2Si2 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | copper(1+);(Z)-2,2,7-trimethyl-5-oxooct-3-en-3-olate;trimethyl(2-trimethylsilylethynyl)silane |
| SMILES | CC(C)CC(=O)/C=C(\[O-])C(C)(C)C.C[Si](C)(C)C#C[Si](C)(C)C.[Cu+] |
| InChI | InChI=1S/C11H20O2.C8H18Si2.Cu/c1-8(2)6-9(12)7-10(13)11(3,4)5;1-9(2,3)7-8-10(4,5)6;/h7-8,13H,6H2,1-5H3;1-6H3;/q;;+1/p-1/b10-7-;; |
| InChIKey | SCNUVXUIMDSZJI-QISVCDMNSA-M |
| XLogP | 4.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|