C22H38CeO4-2 — CID 171030514
cerium;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) (PubChem CID 171030514) has the molecular formula C22H38CeO4-2 and a molecular weight of 506.66 g/mol. Its IUPAC name is cerium;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate).
| Compound Name | cerium;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) |
|---|---|
| PubChem CID | 171030514 |
| Molecular Formula | C22H38CeO4-2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | cerium;bis((Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate) |
| SMILES | CC(C)(C)C(=O)/C=C(\[O-])C(C)(C)C.CC(C)(C)C(=O)/C=C(\[O-])C(C)(C)C.[Ce] |
| InChI | InChI=1S/2C11H20O2.Ce/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/p-2/b2*8-7-; |
| InChIKey | NJUIMVOMXFXJTM-ATMONBRVSA-L |
| XLogP | 3.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|