C10H14O — CID 13317826
(E)-2,6-dimethyloct-5-en-7-yn-4-one (PubChem CID 13317826) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (E)-2,6-dimethyloct-5-en-7-yn-4-one.
| Compound Name | (E)-2,6-dimethyloct-5-en-7-yn-4-one |
|---|---|
| PubChem CID | 13317826 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (E)-2,6-dimethyloct-5-en-7-yn-4-one |
| SMILES | C#C/C(C)=C/C(=O)CC(C)C |
| InChI | InChI=1S/C10H14O/c1-5-9(4)7-10(11)6-8(2)3/h1,7-8H,6H2,2-4H3/b9-7+ |
| InChIKey | SARJOVUDFFMWFG-VQHVLOKHSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|