C17H35N3O3 — CID 159359849
methane;(Z)-6-methyl-2-(methylamino)hept-2-en-4-one;N-methyl-3-(propanoylamino)propanamide (PubChem CID 159359849) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is methane;(Z)-6-methyl-2-(methylamino)hept-2-en-4-one;N-methyl-3-(propanoylamino)propanamide.
| Compound Name | methane;(Z)-6-methyl-2-(methylamino)hept-2-en-4-one;N-methyl-3-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 159359849 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | methane;(Z)-6-methyl-2-(methylamino)hept-2-en-4-one;N-methyl-3-(propanoylamino)propanamide |
| SMILES | C.CCC(=O)NCCC(=O)NC.CN/C(C)=C\C(=O)CC(C)C |
| InChI | InChI=1S/C9H17NO.C7H14N2O2.CH4/c1-7(2)5-9(11)6-8(3)10-4;1-3-6(10)9-5-4-7(11)8-2;/h6-7,10H,5H2,1-4H3;3-5H2,1-2H3,(H,8,11)(H,9,10);1H4/b8-6-;; |
| InChIKey | LIJYJQAKCYMSFB-OTDBEEGXSA-N |
| XLogP | 2.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|