C13H26OSi — CID 129405345
(4S)-3,3-dimethyl-1-trimethylsilyloct-1-yn-4-ol (PubChem CID 129405345) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (4S)-3,3-dimethyl-1-trimethylsilyloct-1-yn-4-ol.
| Compound Name | (4S)-3,3-dimethyl-1-trimethylsilyloct-1-yn-4-ol |
|---|---|
| PubChem CID | 129405345 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (4S)-3,3-dimethyl-1-trimethylsilyloct-1-yn-4-ol |
| SMILES | CCCC[C@H](O)C(C)(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-7-8-9-12(14)13(2,3)10-11-15(4,5)6/h12,14H,7-9H2,1-6H3/t12-/m0/s1 |
| InChIKey | CIEHIYUERPSZSR-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|