C13H26OSi — CID 15399341
(3R,4R)-3-ethyl-1-trimethylsilyloct-1-yn-4-ol (PubChem CID 15399341) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (3R,4R)-3-ethyl-1-trimethylsilyloct-1-yn-4-ol.
| Compound Name | (3R,4R)-3-ethyl-1-trimethylsilyloct-1-yn-4-ol |
|---|---|
| PubChem CID | 15399341 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (3R,4R)-3-ethyl-1-trimethylsilyloct-1-yn-4-ol |
| SMILES | CCCC[C@@H](O)[C@@H](C#C[Si](C)(C)C)CC |
| InChI | InChI=1S/C13H26OSi/c1-6-8-9-13(14)12(7-2)10-11-15(3,4)5/h12-14H,6-9H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | YKNGSQCHDNYVIR-CHWSQXEVSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|